About ethyl 1-(6-fluoro-1,3-benzothiazol-2-yl)cyclopentane-1-carboxylate
ethyl 1-(6-fluoro-1,3-benzothiazol-2-yl)cyclopentane-1-carboxylate (PubChem CID 79471532) has the molecular formula C15H16FNO2S
and a molecular weight of 293.36 g/mol. Its IUPAC name is ethyl 1-(6-fluoro-1,3-benzothiazol-2-yl)cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(6-fluoro-1,3-benzothiazol-2-yl)cyclopentane-1-carboxylate |
| PubChem CID | 79471532 |
| Molecular Formula | C15H16FNO2S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | ethyl 1-(6-fluoro-1,3-benzothiazol-2-yl)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(c2nc3ccc(F)cc3s2)CCCC1 |
| InChI | InChI=1S/C15H16FNO2S/c1-2-19-14(18)15(7-3-4-8-15)13-17-11-6-5-10(16)9-12(11)20-13/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | AWWVCNQOMZJWTJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-(6-fluoro-1,3-benzothiazol-2-yl)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(6-fluoro-1,3-benzothiazol-2-yl)cyclopentane-1-carboxylate?
The IUPAC name of ethyl 1-(6-fluoro-1,3-benzothiazol-2-yl)cyclopentane-1-carboxylate (CID 79471532) is ethyl 1-(6-fluoro-1,3-benzothiazol-2-yl)cyclopentane-1-carboxylate.
What is the SMILES notation for ethyl 1-(6-fluoro-1,3-benzothiazol-2-yl)cyclopentane-1-carboxylate?
The canonical SMILES for ethyl 1-(6-fluoro-1,3-benzothiazol-2-yl)cyclopentane-1-carboxylate is CCOC(=O)C1(c2nc3ccc(F)cc3s2)CCCC1.
What is the InChIKey of ethyl 1-(6-fluoro-1,3-benzothiazol-2-yl)cyclopentane-1-carboxylate?
The InChIKey is AWWVCNQOMZJWTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FNO2S/c1-2-19-14(18)15(7-3-4-8-15)13-17-11-6-5-10(16)9-12(11)20-13/h5-6,9H,2-4,7-8H2,1H3.
What are the key properties of ethyl 1-(6-fluoro-1,3-benzothiazol-2-yl)cyclopentane-1-carboxylate?
ethyl 1-(6-fluoro-1,3-benzothiazol-2-yl)cyclopentane-1-carboxylate has a molecular weight of 293.36 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(6-fluoro-1,3-benzothiazol-2-yl)cyclopentane-1-carboxylate is sourced from PubChem (CID 79471532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).