About ethyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylate
ethyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylate (PubChem CID 79471743) has the molecular formula C10H16N4O2
and a molecular weight of 224.26 g/mol. Its IUPAC name is ethyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylate |
| PubChem CID | 79471743 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | ethyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(c2nc(N)n[nH]2)CCCC1 |
| InChI | InChI=1S/C10H16N4O2/c1-2-16-8(15)10(5-3-4-6-10)7-12-9(11)14-13-7/h2-6H2,1H3,(H3,11,12,13,14) |
| InChIKey | JGYGFOXUNGKJSB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylate?
The IUPAC name of ethyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylate (CID 79471743) is ethyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylate.
What is the SMILES notation for ethyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylate?
The canonical SMILES for ethyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylate is CCOC(=O)C1(c2nc(N)n[nH]2)CCCC1.
What is the InChIKey of ethyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylate?
The InChIKey is JGYGFOXUNGKJSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O2/c1-2-16-8(15)10(5-3-4-6-10)7-12-9(11)14-13-7/h2-6H2,1H3,(H3,11,12,13,14).
What are the key properties of ethyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylate?
ethyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylate has a molecular weight of 224.26 g/mol, XLogP of 0.76, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylate is sourced from PubChem (CID 79471743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).