About ethyl 2-ethyl-2-(5-propyl-1H-1,2,4-triazol-3-yl)butanoate
ethyl 2-ethyl-2-(5-propyl-1H-1,2,4-triazol-3-yl)butanoate (PubChem CID 79471916) has the molecular formula C13H23N3O2
and a molecular weight of 253.35 g/mol. Its IUPAC name is ethyl 2-ethyl-2-(5-propyl-1H-1,2,4-triazol-3-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 2-ethyl-2-(5-propyl-1H-1,2,4-triazol-3-yl)butanoate |
| PubChem CID | 79471916 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | ethyl 2-ethyl-2-(5-propyl-1H-1,2,4-triazol-3-yl)butanoate |
| SMILES | CCCc1nc(C(CC)(CC)C(=O)OCC)n[nH]1 |
| InChI | InChI=1S/C13H23N3O2/c1-5-9-10-14-11(16-15-10)13(6-2,7-3)12(17)18-8-4/h5-9H2,1-4H3,(H,14,15,16) |
| InChIKey | CVECEXVGWVXCGW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-ethyl-2-(5-propyl-1H-1,2,4-triazol-3-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-ethyl-2-(5-propyl-1H-1,2,4-triazol-3-yl)butanoate?
The IUPAC name of ethyl 2-ethyl-2-(5-propyl-1H-1,2,4-triazol-3-yl)butanoate (CID 79471916) is ethyl 2-ethyl-2-(5-propyl-1H-1,2,4-triazol-3-yl)butanoate.
What is the SMILES notation for ethyl 2-ethyl-2-(5-propyl-1H-1,2,4-triazol-3-yl)butanoate?
The canonical SMILES for ethyl 2-ethyl-2-(5-propyl-1H-1,2,4-triazol-3-yl)butanoate is CCCc1nc(C(CC)(CC)C(=O)OCC)n[nH]1.
What is the InChIKey of ethyl 2-ethyl-2-(5-propyl-1H-1,2,4-triazol-3-yl)butanoate?
The InChIKey is CVECEXVGWVXCGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2/c1-5-9-10-14-11(16-15-10)13(6-2,7-3)12(17)18-8-4/h5-9H2,1-4H3,(H,14,15,16).
What are the key properties of ethyl 2-ethyl-2-(5-propyl-1H-1,2,4-triazol-3-yl)butanoate?
ethyl 2-ethyl-2-(5-propyl-1H-1,2,4-triazol-3-yl)butanoate has a molecular weight of 253.35 g/mol, XLogP of 2.38, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-ethyl-2-(5-propyl-1H-1,2,4-triazol-3-yl)butanoate is sourced from PubChem (CID 79471916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).