C14H21FN2O3S — CID 79472536
N-ethyl-4-fluoro-N-(2-methylbutyl)-3-sulfamoylbenzamide (PubChem CID 79472536) has the molecular formula C14H21FN2O3S and a molecular weight of 316.40 g/mol. Its IUPAC name is N-ethyl-4-fluoro-N-(2-methylbutyl)-3-sulfamoylbenzamide.
| Compound Name | N-ethyl-4-fluoro-N-(2-methylbutyl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 79472536 |
| Molecular Formula | C14H21FN2O3S |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-ethyl-4-fluoro-N-(2-methylbutyl)-3-sulfamoylbenzamide |
| SMILES | CCC(C)CN(CC)C(=O)c1ccc(F)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H21FN2O3S/c1-4-10(3)9-17(5-2)14(18)11-6-7-12(15)13(8-11)21(16,19)20/h6-8,10H,4-5,9H2,1-3H3,(H2,16,19,20) |
| InChIKey | JCFUXGRWDCFCDJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |