C13H19N3O4 — CID 79472872
ethyl N-[4-[[2-(2-aminoethoxy)acetyl]amino]phenyl]carbamate (PubChem CID 79472872) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is ethyl N-[4-[[2-(2-aminoethoxy)acetyl]amino]phenyl]carbamate.
| Compound Name | ethyl N-[4-[[2-(2-aminoethoxy)acetyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 79472872 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | ethyl N-[4-[[2-(2-aminoethoxy)acetyl]amino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NC(=O)COCCN)cc1 |
| InChI | InChI=1S/C13H19N3O4/c1-2-20-13(18)16-11-5-3-10(4-6-11)15-12(17)9-19-8-7-14/h3-6H,2,7-9,14H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | LNQQFKYEUVMLFN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|