C12H17N3O2 — CID 79472972
2-(2-aminoethoxy)-1-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone (PubChem CID 79472972) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-1-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone.
| Compound Name | 2-(2-aminoethoxy)-1-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone |
|---|---|
| PubChem CID | 79472972 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 2-(2-aminoethoxy)-1-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone |
| SMILES | NCCOCC(=O)N1CCc2ncccc2C1 |
| InChI | InChI=1S/C12H17N3O2/c13-4-7-17-9-12(16)15-6-3-11-10(8-15)2-1-5-14-11/h1-2,5H,3-4,6-9,13H2 |
| InChIKey | OMFQMYWNNJGRPU-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|