About N-(4-ethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide
N-(4-ethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 7947603) has the molecular formula C24H21N3O2
and a molecular weight of 383.45 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(4-ethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide |
| PubChem CID | 7947603 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-(4-ethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O2/c1-2-29-21-15-13-19(14-16-21)25-24(28)22-17-27(20-11-7-4-8-12-20)26-23(22)18-9-5-3-6-10-18/h3-17H,2H2,1H3,(H,25,28) |
| InChIKey | SHBIAEMDLKCTJP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-ethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide?
The IUPAC name of N-(4-ethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide (CID 7947603) is N-(4-ethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide.
What is the SMILES notation for N-(4-ethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide?
The canonical SMILES for N-(4-ethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide is CCOc1ccc(NC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)cc1.
What is the InChIKey of N-(4-ethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide?
The InChIKey is SHBIAEMDLKCTJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N3O2/c1-2-29-21-15-13-19(14-16-21)25-24(28)22-17-27(20-11-7-4-8-12-20)26-23(22)18-9-5-3-6-10-18/h3-17H,2H2,1H3,(H,25,28).
What are the key properties of N-(4-ethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide?
N-(4-ethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide has a molecular weight of 383.45 g/mol, XLogP of 5.19, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide is sourced from PubChem (CID 7947603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).