C10H18N2O4 — CID 79478387
2-[1-[2-(2-aminoethoxy)acetyl]pyrrolidin-3-yl]acetic acid (PubChem CID 79478387) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-[1-[2-(2-aminoethoxy)acetyl]pyrrolidin-3-yl]acetic acid.
| Compound Name | 2-[1-[2-(2-aminoethoxy)acetyl]pyrrolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 79478387 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-[1-[2-(2-aminoethoxy)acetyl]pyrrolidin-3-yl]acetic acid |
| SMILES | NCCOCC(=O)N1CCC(CC(=O)O)C1 |
| InChI | InChI=1S/C10H18N2O4/c11-2-4-16-7-9(13)12-3-1-8(6-12)5-10(14)15/h8H,1-7,11H2,(H,14,15) |
| InChIKey | MBWKDDKYSBXLAH-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|