About 2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]ethanamine
2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]ethanamine (PubChem CID 79478924) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]ethanamine.
Molecular Properties
| Compound Name | 2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]ethanamine |
| PubChem CID | 79478924 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]ethanamine |
| SMILES | CC1CC(C)CN(CCOCCN)C1 |
| InChI | InChI=1S/C11H24N2O/c1-10-7-11(2)9-13(8-10)4-6-14-5-3-12/h10-11H,3-9,12H2,1-2H3 |
| InChIKey | QNOJPOGHVPDAFA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]ethanamine?
The IUPAC name of 2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]ethanamine (CID 79478924) is 2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]ethanamine.
What is the SMILES notation for 2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]ethanamine?
The canonical SMILES for 2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]ethanamine is CC1CC(C)CN(CCOCCN)C1.
What is the InChIKey of 2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]ethanamine?
The InChIKey is QNOJPOGHVPDAFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O/c1-10-7-11(2)9-13(8-10)4-6-14-5-3-12/h10-11H,3-9,12H2,1-2H3.
What are the key properties of 2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]ethanamine?
2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]ethanamine has a molecular weight of 200.33 g/mol, XLogP of 0.94, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]ethanamine is sourced from PubChem (CID 79478924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).