About N'-ethyl-N'-(2-methylbutyl)-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine
N'-ethyl-N'-(2-methylbutyl)-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine (PubChem CID 79482754) has the molecular formula C15H28N2S
and a molecular weight of 268.47 g/mol. Its IUPAC name is N'-ethyl-N'-(2-methylbutyl)-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-ethyl-N'-(2-methylbutyl)-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine |
| PubChem CID | 79482754 |
| Molecular Formula | C15H28N2S |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | N'-ethyl-N'-(2-methylbutyl)-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine |
| SMILES | CCC(C)CN(CC)CCNC(C)c1cccs1 |
| InChI | InChI=1S/C15H28N2S/c1-5-13(3)12-17(6-2)10-9-16-14(4)15-8-7-11-18-15/h7-8,11,13-14,16H,5-6,9-10,12H2,1-4H3 |
| InChIKey | YYNGVCWYCTWKKY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-ethyl-N'-(2-methylbutyl)-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-(2-methylbutyl)-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine?
The IUPAC name of N'-ethyl-N'-(2-methylbutyl)-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine (CID 79482754) is N'-ethyl-N'-(2-methylbutyl)-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine.
What is the SMILES notation for N'-ethyl-N'-(2-methylbutyl)-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine?
The canonical SMILES for N'-ethyl-N'-(2-methylbutyl)-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine is CCC(C)CN(CC)CCNC(C)c1cccs1.
What is the InChIKey of N'-ethyl-N'-(2-methylbutyl)-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine?
The InChIKey is YYNGVCWYCTWKKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2S/c1-5-13(3)12-17(6-2)10-9-16-14(4)15-8-7-11-18-15/h7-8,11,13-14,16H,5-6,9-10,12H2,1-4H3.
What are the key properties of N'-ethyl-N'-(2-methylbutyl)-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine?
N'-ethyl-N'-(2-methylbutyl)-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine has a molecular weight of 268.47 g/mol, XLogP of 3.77, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-(2-methylbutyl)-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine is sourced from PubChem (CID 79482754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).