C15H28ClN3 — CID 79483802
4-(chloromethyl)-1,3-dimethyl-N-(2-methylpropyl)-N-pentan-3-ylpyrazol-5-amine (PubChem CID 79483802) has the molecular formula C15H28ClN3 and a molecular weight of 285.86 g/mol. Its IUPAC name is 4-(chloromethyl)-1,3-dimethyl-N-(2-methylpropyl)-N-pentan-3-ylpyrazol-5-amine.
| Compound Name | 4-(chloromethyl)-1,3-dimethyl-N-(2-methylpropyl)-N-pentan-3-ylpyrazol-5-amine |
|---|---|
| PubChem CID | 79483802 |
| Molecular Formula | C15H28ClN3 |
| Molecular Weight | 285.86 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 4-(chloromethyl)-1,3-dimethyl-N-(2-methylpropyl)-N-pentan-3-ylpyrazol-5-amine |
| SMILES | CCC(CC)N(CC(C)C)c1c(CCl)c(C)nn1C |
| InChI | InChI=1S/C15H28ClN3/c1-7-13(8-2)19(10-11(3)4)15-14(9-16)12(5)17-18(15)6/h11,13H,7-10H2,1-6H3 |
| InChIKey | WYQIGXXPCCWCIA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.86 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|