C17H38N2 — CID 79483858
5-N-ethyl-1-N-(2-methylpropyl)-1-N-pentan-3-ylhexane-1,5-diamine (PubChem CID 79483858) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is 5-N-ethyl-1-N-(2-methylpropyl)-1-N-pentan-3-ylhexane-1,5-diamine.
| Compound Name | 5-N-ethyl-1-N-(2-methylpropyl)-1-N-pentan-3-ylhexane-1,5-diamine |
|---|---|
| PubChem CID | 79483858 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | 5-N-ethyl-1-N-(2-methylpropyl)-1-N-pentan-3-ylhexane-1,5-diamine |
| SMILES | CCNC(C)CCCCN(CC(C)C)C(CC)CC |
| InChI | InChI=1S/C17H38N2/c1-7-17(8-2)19(14-15(4)5)13-11-10-12-16(6)18-9-3/h15-18H,7-14H2,1-6H3 |
| InChIKey | MJOQFKZFYRJGOJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|