C16H23F2NO — CID 79484068
2,3-difluoro-N-(2-methylpropyl)-N-pentan-3-ylbenzamide (PubChem CID 79484068) has the molecular formula C16H23F2NO and a molecular weight of 283.36 g/mol. Its IUPAC name is 2,3-difluoro-N-(2-methylpropyl)-N-pentan-3-ylbenzamide.
| Compound Name | 2,3-difluoro-N-(2-methylpropyl)-N-pentan-3-ylbenzamide |
|---|---|
| PubChem CID | 79484068 |
| Molecular Formula | C16H23F2NO |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2,3-difluoro-N-(2-methylpropyl)-N-pentan-3-ylbenzamide |
| SMILES | CCC(CC)N(CC(C)C)C(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C16H23F2NO/c1-5-12(6-2)19(10-11(3)4)16(20)13-8-7-9-14(17)15(13)18/h7-9,11-12H,5-6,10H2,1-4H3 |
| InChIKey | RVLVWKXYFHIHBK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |