About N-[[5-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1H-pyrazol-4-yl]methyl]ethanamine
N-[[5-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1H-pyrazol-4-yl]methyl]ethanamine (PubChem CID 79484480) has the molecular formula C13H14ClN5
and a molecular weight of 275.74 g/mol. Its IUPAC name is N-[[5-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1H-pyrazol-4-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[5-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1H-pyrazol-4-yl]methyl]ethanamine |
| PubChem CID | 79484480 |
| Molecular Formula | C13H14ClN5 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-[[5-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1H-pyrazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1cn[nH]c1-c1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C13H14ClN5/c1-2-15-7-9-8-16-18-11(9)12-13(14)17-10-5-3-4-6-19(10)12/h3-6,8,15H,2,7H2,1H3,(H,16,18) |
| InChIKey | WAPTVBDGSIUBHB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[5-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1H-pyrazol-4-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1H-pyrazol-4-yl]methyl]ethanamine?
The IUPAC name of N-[[5-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1H-pyrazol-4-yl]methyl]ethanamine (CID 79484480) is N-[[5-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1H-pyrazol-4-yl]methyl]ethanamine.
What is the SMILES notation for N-[[5-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1H-pyrazol-4-yl]methyl]ethanamine?
The canonical SMILES for N-[[5-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1H-pyrazol-4-yl]methyl]ethanamine is CCNCc1cn[nH]c1-c1c(Cl)nc2ccccn12.
What is the InChIKey of N-[[5-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1H-pyrazol-4-yl]methyl]ethanamine?
The InChIKey is WAPTVBDGSIUBHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN5/c1-2-15-7-9-8-16-18-11(9)12-13(14)17-10-5-3-4-6-19(10)12/h3-6,8,15H,2,7H2,1H3,(H,16,18).
What are the key properties of N-[[5-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1H-pyrazol-4-yl]methyl]ethanamine?
N-[[5-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1H-pyrazol-4-yl]methyl]ethanamine has a molecular weight of 275.74 g/mol, XLogP of 2.49, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(2-chloroimidazo[1,2-a]pyridin-3-yl)-1H-pyrazol-4-yl]methyl]ethanamine is sourced from PubChem (CID 79484480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).