About 1-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-N-methylmethanamine
1-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-N-methylmethanamine (PubChem CID 79485630) has the molecular formula C11H11F2N3
and a molecular weight of 223.23 g/mol. Its IUPAC name is 1-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-N-methylmethanamine |
| PubChem CID | 79485630 |
| Molecular Formula | C11H11F2N3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 1-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-N-methylmethanamine |
| SMILES | CNCc1cn[nH]c1-c1c(F)cccc1F |
| InChI | InChI=1S/C11H11F2N3/c1-14-5-7-6-15-16-11(7)10-8(12)3-2-4-9(10)13/h2-4,6,14H,5H2,1H3,(H,15,16) |
| InChIKey | HBRBZFPJHSNKGL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-N-methylmethanamine?
The IUPAC name of 1-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-N-methylmethanamine (CID 79485630) is 1-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-N-methylmethanamine.
What is the SMILES notation for 1-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-N-methylmethanamine?
The canonical SMILES for 1-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-N-methylmethanamine is CNCc1cn[nH]c1-c1c(F)cccc1F.
What is the InChIKey of 1-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-N-methylmethanamine?
The InChIKey is HBRBZFPJHSNKGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2N3/c1-14-5-7-6-15-16-11(7)10-8(12)3-2-4-9(10)13/h2-4,6,14H,5H2,1H3,(H,15,16).
What are the key properties of 1-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-N-methylmethanamine?
1-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-N-methylmethanamine has a molecular weight of 223.23 g/mol, XLogP of 2.07, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2,6-difluorophenyl)-1H-pyrazol-4-yl]-N-methylmethanamine is sourced from PubChem (CID 79485630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).