C13H21NO2S — CID 79485922
2-methyl-2-[[methyl(2-thiophen-2-ylethyl)amino]methyl]butanoic acid (PubChem CID 79485922) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is 2-methyl-2-[[methyl(2-thiophen-2-ylethyl)amino]methyl]butanoic acid.
| Compound Name | 2-methyl-2-[[methyl(2-thiophen-2-ylethyl)amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 79485922 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-methyl-2-[[methyl(2-thiophen-2-ylethyl)amino]methyl]butanoic acid |
| SMILES | CCC(C)(CN(C)CCc1cccs1)C(=O)O |
| InChI | InChI=1S/C13H21NO2S/c1-4-13(2,12(15)16)10-14(3)8-7-11-6-5-9-17-11/h5-6,9H,4,7-8,10H2,1-3H3,(H,15,16) |
| InChIKey | VUUOBRARMZRABO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |