C13H18N3OS+ — CID 79486718
N,3-dimethyl-N-(1-thiophen-2-ylpropan-2-yl)imidazol-3-ium-1-carboxamide (PubChem CID 79486718) has the molecular formula C13H18N3OS+ and a molecular weight of 264.37 g/mol. Its IUPAC name is N,3-dimethyl-N-(1-thiophen-2-ylpropan-2-yl)imidazol-3-ium-1-carboxamide.
| Compound Name | N,3-dimethyl-N-(1-thiophen-2-ylpropan-2-yl)imidazol-3-ium-1-carboxamide |
|---|---|
| PubChem CID | 79486718 |
| Molecular Formula | C13H18N3OS+ |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | N,3-dimethyl-N-(1-thiophen-2-ylpropan-2-yl)imidazol-3-ium-1-carboxamide |
| SMILES | CC(Cc1cccs1)N(C)C(=O)n1cc[n+](C)c1 |
| InChI | InChI=1S/C13H18N3OS/c1-11(9-12-5-4-8-18-12)15(3)13(17)16-7-6-14(2)10-16/h4-8,10-11H,9H2,1-3H3/q+1 |
| InChIKey | HZOMSPIXYCCUHI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|