C15H18FN3O2 — CID 79486996
2-(1-amino-2,2-dimethylpropyl)-5-(3-fluorophenyl)-1H-pyrimidine-4,6-dione (PubChem CID 79486996) has the molecular formula C15H18FN3O2 and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-(1-amino-2,2-dimethylpropyl)-5-(3-fluorophenyl)-1H-pyrimidine-4,6-dione.
| Compound Name | 2-(1-amino-2,2-dimethylpropyl)-5-(3-fluorophenyl)-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 79486996 |
| Molecular Formula | C15H18FN3O2 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-(1-amino-2,2-dimethylpropyl)-5-(3-fluorophenyl)-1H-pyrimidine-4,6-dione |
| SMILES | CC(C)(C)C(N)C1=NC(=O)C(c2cccc(F)c2)C(=O)N1 |
| InChI | InChI=1S/C15H18FN3O2/c1-15(2,3)11(17)12-18-13(20)10(14(21)19-12)8-5-4-6-9(16)7-8/h4-7,10-11H,17H2,1-3H3,(H,18,19,20,21) |
| InChIKey | WMBYORJBKOKGGB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|