About 4-[(3,5-dichlorophenyl)iminomethyl]benzene-1,3-diol
4-[(3,5-dichlorophenyl)iminomethyl]benzene-1,3-diol (PubChem CID 794875) has the molecular formula C13H9Cl2NO2
and a molecular weight of 282.13 g/mol. Its IUPAC name is 4-[(3,5-dichlorophenyl)iminomethyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-[(3,5-dichlorophenyl)iminomethyl]benzene-1,3-diol |
| PubChem CID | 794875 |
| Molecular Formula | C13H9Cl2NO2 |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 4-[(3,5-dichlorophenyl)iminomethyl]benzene-1,3-diol |
| SMILES | Oc1ccc(/C=N/c2cc(Cl)cc(Cl)c2)c(O)c1 |
| InChI | InChI=1S/C13H9Cl2NO2/c14-9-3-10(15)5-11(4-9)16-7-8-1-2-12(17)6-13(8)18/h1-7,17-18H/b16-7+ |
| InChIKey | LHXTUTIWKPGLMO-FRKPEAEDSA-N |
| XLogP | 4.16 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,5-dichlorophenyl)iminomethyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-dichlorophenyl)iminomethyl]benzene-1,3-diol?
The IUPAC name of 4-[(3,5-dichlorophenyl)iminomethyl]benzene-1,3-diol (CID 794875) is 4-[(3,5-dichlorophenyl)iminomethyl]benzene-1,3-diol.
What is the SMILES notation for 4-[(3,5-dichlorophenyl)iminomethyl]benzene-1,3-diol?
The canonical SMILES for 4-[(3,5-dichlorophenyl)iminomethyl]benzene-1,3-diol is Oc1ccc(/C=N/c2cc(Cl)cc(Cl)c2)c(O)c1.
What is the InChIKey of 4-[(3,5-dichlorophenyl)iminomethyl]benzene-1,3-diol?
The InChIKey is LHXTUTIWKPGLMO-FRKPEAEDSA-N. The full InChI is InChI=1S/C13H9Cl2NO2/c14-9-3-10(15)5-11(4-9)16-7-8-1-2-12(17)6-13(8)18/h1-7,17-18H/b16-7+.
What are the key properties of 4-[(3,5-dichlorophenyl)iminomethyl]benzene-1,3-diol?
4-[(3,5-dichlorophenyl)iminomethyl]benzene-1,3-diol has a molecular weight of 282.13 g/mol, XLogP of 4.16, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-dichlorophenyl)iminomethyl]benzene-1,3-diol is sourced from PubChem (CID 794875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).