C13H20N2O3S2 — CID 79487537
4-methylsulfanyl-2-[[methyl(2-thiophen-2-ylethyl)carbamoyl]amino]butanoic acid (PubChem CID 79487537) has the molecular formula C13H20N2O3S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[[methyl(2-thiophen-2-ylethyl)carbamoyl]amino]butanoic acid.
| Compound Name | 4-methylsulfanyl-2-[[methyl(2-thiophen-2-ylethyl)carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 79487537 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-methylsulfanyl-2-[[methyl(2-thiophen-2-ylethyl)carbamoyl]amino]butanoic acid |
| SMILES | CSCCC(NC(=O)N(C)CCc1cccs1)C(=O)O |
| InChI | InChI=1S/C13H20N2O3S2/c1-15(7-5-10-4-3-8-20-10)13(18)14-11(12(16)17)6-9-19-2/h3-4,8,11H,5-7,9H2,1-2H3,(H,14,18)(H,16,17) |
| InChIKey | URTWEEAWPLOBOO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |