About [5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]methanamine
[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]methanamine (PubChem CID 79487594) has the molecular formula C7H8N4S
and a molecular weight of 180.24 g/mol. Its IUPAC name is [5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]methanamine.
Molecular Properties
| Compound Name | [5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]methanamine |
| PubChem CID | 79487594 |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | [5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]methanamine |
| SMILES | NCc1cn[nH]c1-c1nccs1 |
| InChI | InChI=1S/C7H8N4S/c8-3-5-4-10-11-6(5)7-9-1-2-12-7/h1-2,4H,3,8H2,(H,10,11) |
| InChIKey | QMVNKCAHZLUFCX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]methanamine?
The IUPAC name of [5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]methanamine (CID 79487594) is [5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]methanamine.
What is the SMILES notation for [5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]methanamine?
The canonical SMILES for [5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]methanamine is NCc1cn[nH]c1-c1nccs1.
What is the InChIKey of [5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]methanamine?
The InChIKey is QMVNKCAHZLUFCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4S/c8-3-5-4-10-11-6(5)7-9-1-2-12-7/h1-2,4H,3,8H2,(H,10,11).
What are the key properties of [5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]methanamine?
[5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]methanamine has a molecular weight of 180.24 g/mol, XLogP of 0.99, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1,3-thiazol-2-yl)-1H-pyrazol-4-yl]methanamine is sourced from PubChem (CID 79487594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).