C15H32N2O — CID 79489290
N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-(2-methylpropyl)pentan-3-amine (PubChem CID 79489290) has the molecular formula C15H32N2O and a molecular weight of 256.43 g/mol. Its IUPAC name is N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-(2-methylpropyl)pentan-3-amine.
| Compound Name | N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-(2-methylpropyl)pentan-3-amine |
|---|---|
| PubChem CID | 79489290 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-(2-methylpropyl)pentan-3-amine |
| SMILES | CCC(CC)N(CC(C)C)CC1(CN)CCOC1 |
| InChI | InChI=1S/C15H32N2O/c1-5-14(6-2)17(9-13(3)4)11-15(10-16)7-8-18-12-15/h13-14H,5-12,16H2,1-4H3 |
| InChIKey | KSNABZPTUMYVBQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |