C15H23N3OS2 — CID 79490864
5-[(2-methoxyethylamino)methyl]-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)-1,3-thiazol-2-amine (PubChem CID 79490864) has the molecular formula C15H23N3OS2 and a molecular weight of 325.50 g/mol. Its IUPAC name is 5-[(2-methoxyethylamino)methyl]-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 5-[(2-methoxyethylamino)methyl]-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79490864 |
| Molecular Formula | C15H23N3OS2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 5-[(2-methoxyethylamino)methyl]-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)-1,3-thiazol-2-amine |
| SMILES | COCCNCc1cnc(N(C)C(C)Cc2cccs2)s1 |
| InChI | InChI=1S/C15H23N3OS2/c1-12(9-13-5-4-8-20-13)18(2)15-17-11-14(21-15)10-16-6-7-19-3/h4-5,8,11-12,16H,6-7,9-10H2,1-3H3 |
| InChIKey | IKHXEWFYQJZEPI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|