C16H19N3S2 — CID 79491710
2-[methyl(2-thiophen-2-ylethyl)amino]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide (PubChem CID 79491710) has the molecular formula C16H19N3S2 and a molecular weight of 317.48 g/mol. Its IUPAC name is 2-[methyl(2-thiophen-2-ylethyl)amino]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide.
| Compound Name | 2-[methyl(2-thiophen-2-ylethyl)amino]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 79491710 |
| Molecular Formula | C16H19N3S2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-[methyl(2-thiophen-2-ylethyl)amino]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide |
| SMILES | CN(CCc1cccs1)c1nc2c(cc1C(N)=S)CCC2 |
| InChI | InChI=1S/C16H19N3S2/c1-19(8-7-12-5-3-9-21-12)16-13(15(17)20)10-11-4-2-6-14(11)18-16/h3,5,9-10H,2,4,6-8H2,1H3,(H2,17,20) |
| InChIKey | URSNXHOZCMSELO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|