About N-(1,2-oxazol-3-ylmethyl)thieno[3,2-c]pyridin-4-amine
N-(1,2-oxazol-3-ylmethyl)thieno[3,2-c]pyridin-4-amine (PubChem CID 79492609) has the molecular formula C11H9N3OS
and a molecular weight of 231.28 g/mol. Its IUPAC name is N-(1,2-oxazol-3-ylmethyl)thieno[3,2-c]pyridin-4-amine.
Molecular Properties
| Compound Name | N-(1,2-oxazol-3-ylmethyl)thieno[3,2-c]pyridin-4-amine |
| PubChem CID | 79492609 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | N-(1,2-oxazol-3-ylmethyl)thieno[3,2-c]pyridin-4-amine |
| SMILES | c1cc2sccc2c(NCc2ccon2)n1 |
| InChI | InChI=1S/C11H9N3OS/c1-4-12-11(9-3-6-16-10(1)9)13-7-8-2-5-15-14-8/h1-6H,7H2,(H,12,13) |
| InChIKey | AUTSCFBTGVURLU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,2-oxazol-3-ylmethyl)thieno[3,2-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,2-oxazol-3-ylmethyl)thieno[3,2-c]pyridin-4-amine?
The IUPAC name of N-(1,2-oxazol-3-ylmethyl)thieno[3,2-c]pyridin-4-amine (CID 79492609) is N-(1,2-oxazol-3-ylmethyl)thieno[3,2-c]pyridin-4-amine.
What is the SMILES notation for N-(1,2-oxazol-3-ylmethyl)thieno[3,2-c]pyridin-4-amine?
The canonical SMILES for N-(1,2-oxazol-3-ylmethyl)thieno[3,2-c]pyridin-4-amine is c1cc2sccc2c(NCc2ccon2)n1.
What is the InChIKey of N-(1,2-oxazol-3-ylmethyl)thieno[3,2-c]pyridin-4-amine?
The InChIKey is AUTSCFBTGVURLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3OS/c1-4-12-11(9-3-6-16-10(1)9)13-7-8-2-5-15-14-8/h1-6H,7H2,(H,12,13).
What are the key properties of N-(1,2-oxazol-3-ylmethyl)thieno[3,2-c]pyridin-4-amine?
N-(1,2-oxazol-3-ylmethyl)thieno[3,2-c]pyridin-4-amine has a molecular weight of 231.28 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,2-oxazol-3-ylmethyl)thieno[3,2-c]pyridin-4-amine is sourced from PubChem (CID 79492609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).