C8H15N3O2 — CID 79492637
2,2-dimethoxy-1-(2-methylpyrazol-3-yl)ethanamine (PubChem CID 79492637) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 2,2-dimethoxy-1-(2-methylpyrazol-3-yl)ethanamine.
| Compound Name | 2,2-dimethoxy-1-(2-methylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 79492637 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2,2-dimethoxy-1-(2-methylpyrazol-3-yl)ethanamine |
| SMILES | COC(OC)C(N)c1ccnn1C |
| InChI | InChI=1S/C8H15N3O2/c1-11-6(4-5-10-11)7(9)8(12-2)13-3/h4-5,7-8H,9H2,1-3H3 |
| InChIKey | REPYTGBIOBYFEP-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|