C11H8FN3O — CID 79492719
2-fluoro-6-(1,2-oxazol-3-ylmethylamino)benzonitrile (PubChem CID 79492719) has the molecular formula C11H8FN3O and a molecular weight of 217.20 g/mol. Its IUPAC name is 2-fluoro-6-(1,2-oxazol-3-ylmethylamino)benzonitrile.
| Compound Name | 2-fluoro-6-(1,2-oxazol-3-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 79492719 |
| Molecular Formula | C11H8FN3O |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-fluoro-6-(1,2-oxazol-3-ylmethylamino)benzonitrile |
| SMILES | N#Cc1c(F)cccc1NCc1ccon1 |
| InChI | InChI=1S/C11H8FN3O/c12-10-2-1-3-11(9(10)6-13)14-7-8-4-5-16-15-8/h1-5,14H,7H2 |
| InChIKey | IWOJNKIZIUGZCC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |