About 5-ethylsulfonyl-1,1-dimethoxy-N-propylpentan-2-amine
5-ethylsulfonyl-1,1-dimethoxy-N-propylpentan-2-amine (PubChem CID 79493276) has the molecular formula C12H27NO4S
and a molecular weight of 281.42 g/mol. Its IUPAC name is 5-ethylsulfonyl-1,1-dimethoxy-N-propylpentan-2-amine.
Molecular Properties
| Compound Name | 5-ethylsulfonyl-1,1-dimethoxy-N-propylpentan-2-amine |
| PubChem CID | 79493276 |
| Molecular Formula | C12H27NO4S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 5-ethylsulfonyl-1,1-dimethoxy-N-propylpentan-2-amine |
| SMILES | CCCNC(CCCS(=O)(=O)CC)C(OC)OC |
| InChI | InChI=1S/C12H27NO4S/c1-5-9-13-11(12(16-3)17-4)8-7-10-18(14,15)6-2/h11-13H,5-10H2,1-4H3 |
| InChIKey | BROXODFHLCRAQA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylsulfonyl-1,1-dimethoxy-N-propylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylsulfonyl-1,1-dimethoxy-N-propylpentan-2-amine?
The IUPAC name of 5-ethylsulfonyl-1,1-dimethoxy-N-propylpentan-2-amine (CID 79493276) is 5-ethylsulfonyl-1,1-dimethoxy-N-propylpentan-2-amine.
What is the SMILES notation for 5-ethylsulfonyl-1,1-dimethoxy-N-propylpentan-2-amine?
The canonical SMILES for 5-ethylsulfonyl-1,1-dimethoxy-N-propylpentan-2-amine is CCCNC(CCCS(=O)(=O)CC)C(OC)OC.
What is the InChIKey of 5-ethylsulfonyl-1,1-dimethoxy-N-propylpentan-2-amine?
The InChIKey is BROXODFHLCRAQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27NO4S/c1-5-9-13-11(12(16-3)17-4)8-7-10-18(14,15)6-2/h11-13H,5-10H2,1-4H3.
What are the key properties of 5-ethylsulfonyl-1,1-dimethoxy-N-propylpentan-2-amine?
5-ethylsulfonyl-1,1-dimethoxy-N-propylpentan-2-amine has a molecular weight of 281.42 g/mol, XLogP of 1.19, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylsulfonyl-1,1-dimethoxy-N-propylpentan-2-amine is sourced from PubChem (CID 79493276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).