C12H18FNO3 — CID 79493441
3-(3-fluoro-4-methoxyphenyl)-1,1-dimethoxypropan-2-amine (PubChem CID 79493441) has the molecular formula C12H18FNO3 and a molecular weight of 243.28 g/mol. Its IUPAC name is 3-(3-fluoro-4-methoxyphenyl)-1,1-dimethoxypropan-2-amine.
| Compound Name | 3-(3-fluoro-4-methoxyphenyl)-1,1-dimethoxypropan-2-amine |
|---|---|
| PubChem CID | 79493441 |
| Molecular Formula | C12H18FNO3 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 3-(3-fluoro-4-methoxyphenyl)-1,1-dimethoxypropan-2-amine |
| SMILES | COc1ccc(CC(N)C(OC)OC)cc1F |
| InChI | InChI=1S/C12H18FNO3/c1-15-11-5-4-8(6-9(11)13)7-10(14)12(16-2)17-3/h4-6,10,12H,7,14H2,1-3H3 |
| InChIKey | SZOQTPQFYZPLJR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|