About 1-(furan-3-yl)-N-(1,2-oxazol-3-ylmethyl)methanamine
1-(furan-3-yl)-N-(1,2-oxazol-3-ylmethyl)methanamine (PubChem CID 79493496) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 1-(furan-3-yl)-N-(1,2-oxazol-3-ylmethyl)methanamine.
Molecular Properties
| Compound Name | 1-(furan-3-yl)-N-(1,2-oxazol-3-ylmethyl)methanamine |
| PubChem CID | 79493496 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 1-(furan-3-yl)-N-(1,2-oxazol-3-ylmethyl)methanamine |
| SMILES | c1cc(CNCc2ccon2)co1 |
| InChI | InChI=1S/C9H10N2O2/c1-3-12-7-8(1)5-10-6-9-2-4-13-11-9/h1-4,7,10H,5-6H2 |
| InChIKey | NTYITAGDZAASTH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 51.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(furan-3-yl)-N-(1,2-oxazol-3-ylmethyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-3-yl)-N-(1,2-oxazol-3-ylmethyl)methanamine?
The IUPAC name of 1-(furan-3-yl)-N-(1,2-oxazol-3-ylmethyl)methanamine (CID 79493496) is 1-(furan-3-yl)-N-(1,2-oxazol-3-ylmethyl)methanamine.
What is the SMILES notation for 1-(furan-3-yl)-N-(1,2-oxazol-3-ylmethyl)methanamine?
The canonical SMILES for 1-(furan-3-yl)-N-(1,2-oxazol-3-ylmethyl)methanamine is c1cc(CNCc2ccon2)co1.
What is the InChIKey of 1-(furan-3-yl)-N-(1,2-oxazol-3-ylmethyl)methanamine?
The InChIKey is NTYITAGDZAASTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-3-12-7-8(1)5-10-6-9-2-4-13-11-9/h1-4,7,10H,5-6H2.
What are the key properties of 1-(furan-3-yl)-N-(1,2-oxazol-3-ylmethyl)methanamine?
1-(furan-3-yl)-N-(1,2-oxazol-3-ylmethyl)methanamine has a molecular weight of 178.19 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-3-yl)-N-(1,2-oxazol-3-ylmethyl)methanamine is sourced from PubChem (CID 79493496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).