About 3-(2-fluorophenyl)-1,1-dimethoxypropan-2-amine
3-(2-fluorophenyl)-1,1-dimethoxypropan-2-amine (PubChem CID 79493645) has the molecular formula C11H16FNO2
and a molecular weight of 213.25 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1,1-dimethoxypropan-2-amine.
Molecular Properties
| Compound Name | 3-(2-fluorophenyl)-1,1-dimethoxypropan-2-amine |
| PubChem CID | 79493645 |
| Molecular Formula | C11H16FNO2 |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 3-(2-fluorophenyl)-1,1-dimethoxypropan-2-amine |
| SMILES | COC(OC)C(N)Cc1ccccc1F |
| InChI | InChI=1S/C11H16FNO2/c1-14-11(15-2)10(13)7-8-5-3-4-6-9(8)12/h3-6,10-11H,7,13H2,1-2H3 |
| InChIKey | YECVANKPOIXCNF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-fluorophenyl)-1,1-dimethoxypropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-fluorophenyl)-1,1-dimethoxypropan-2-amine?
The IUPAC name of 3-(2-fluorophenyl)-1,1-dimethoxypropan-2-amine (CID 79493645) is 3-(2-fluorophenyl)-1,1-dimethoxypropan-2-amine.
What is the SMILES notation for 3-(2-fluorophenyl)-1,1-dimethoxypropan-2-amine?
The canonical SMILES for 3-(2-fluorophenyl)-1,1-dimethoxypropan-2-amine is COC(OC)C(N)Cc1ccccc1F.
What is the InChIKey of 3-(2-fluorophenyl)-1,1-dimethoxypropan-2-amine?
The InChIKey is YECVANKPOIXCNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16FNO2/c1-14-11(15-2)10(13)7-8-5-3-4-6-9(8)12/h3-6,10-11H,7,13H2,1-2H3.
What are the key properties of 3-(2-fluorophenyl)-1,1-dimethoxypropan-2-amine?
3-(2-fluorophenyl)-1,1-dimethoxypropan-2-amine has a molecular weight of 213.25 g/mol, XLogP of 1.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-fluorophenyl)-1,1-dimethoxypropan-2-amine is sourced from PubChem (CID 79493645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).