C15H24FNO3 — CID 79495027
2,2-diethoxy-N-ethyl-1-(3-fluoro-4-methoxyphenyl)ethanamine (PubChem CID 79495027) has the molecular formula C15H24FNO3 and a molecular weight of 285.36 g/mol. Its IUPAC name is 2,2-diethoxy-N-ethyl-1-(3-fluoro-4-methoxyphenyl)ethanamine.
| Compound Name | 2,2-diethoxy-N-ethyl-1-(3-fluoro-4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 79495027 |
| Molecular Formula | C15H24FNO3 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2,2-diethoxy-N-ethyl-1-(3-fluoro-4-methoxyphenyl)ethanamine |
| SMILES | CCNC(c1ccc(OC)c(F)c1)C(OCC)OCC |
| InChI | InChI=1S/C15H24FNO3/c1-5-17-14(15(19-6-2)20-7-3)11-8-9-13(18-4)12(16)10-11/h8-10,14-15,17H,5-7H2,1-4H3 |
| InChIKey | BLDYNOZDWYSHKT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|