C17H35NO2 — CID 79495323
N-[2,2-diethoxy-1-(3-ethylcyclohexyl)ethyl]propan-1-amine (PubChem CID 79495323) has the molecular formula C17H35NO2 and a molecular weight of 285.47 g/mol. Its IUPAC name is N-[2,2-diethoxy-1-(3-ethylcyclohexyl)ethyl]propan-1-amine.
| Compound Name | N-[2,2-diethoxy-1-(3-ethylcyclohexyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 79495323 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | N-[2,2-diethoxy-1-(3-ethylcyclohexyl)ethyl]propan-1-amine |
| SMILES | CCCNC(C1CCCC(CC)C1)C(OCC)OCC |
| InChI | InChI=1S/C17H35NO2/c1-5-12-18-16(17(19-7-3)20-8-4)15-11-9-10-14(6-2)13-15/h14-18H,5-13H2,1-4H3 |
| InChIKey | XKEJKNNJXAKSFR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|