C12H23N3O2 — CID 79495409
2,2-diethoxy-N-ethyl-1-(1-methylpyrazol-4-yl)ethanamine (PubChem CID 79495409) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is 2,2-diethoxy-N-ethyl-1-(1-methylpyrazol-4-yl)ethanamine.
| Compound Name | 2,2-diethoxy-N-ethyl-1-(1-methylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 79495409 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 2,2-diethoxy-N-ethyl-1-(1-methylpyrazol-4-yl)ethanamine |
| SMILES | CCNC(c1cnn(C)c1)C(OCC)OCC |
| InChI | InChI=1S/C12H23N3O2/c1-5-13-11(10-8-14-15(4)9-10)12(16-6-2)17-7-3/h8-9,11-13H,5-7H2,1-4H3 |
| InChIKey | SLKVANSBQSQDMK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|