About [5-[(1,2-oxazol-3-ylmethylamino)methyl]furan-2-yl]methanol
[5-[(1,2-oxazol-3-ylmethylamino)methyl]furan-2-yl]methanol (PubChem CID 79496028) has the molecular formula C10H12N2O3
and a molecular weight of 208.22 g/mol. Its IUPAC name is [5-[(1,2-oxazol-3-ylmethylamino)methyl]furan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-[(1,2-oxazol-3-ylmethylamino)methyl]furan-2-yl]methanol |
| PubChem CID | 79496028 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | [5-[(1,2-oxazol-3-ylmethylamino)methyl]furan-2-yl]methanol |
| SMILES | OCc1ccc(CNCc2ccon2)o1 |
| InChI | InChI=1S/C10H12N2O3/c13-7-10-2-1-9(15-10)6-11-5-8-3-4-14-12-8/h1-4,11,13H,5-7H2 |
| InChIKey | LSGKDPWYWOGHPK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-[(1,2-oxazol-3-ylmethylamino)methyl]furan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(1,2-oxazol-3-ylmethylamino)methyl]furan-2-yl]methanol?
The IUPAC name of [5-[(1,2-oxazol-3-ylmethylamino)methyl]furan-2-yl]methanol (CID 79496028) is [5-[(1,2-oxazol-3-ylmethylamino)methyl]furan-2-yl]methanol.
What is the SMILES notation for [5-[(1,2-oxazol-3-ylmethylamino)methyl]furan-2-yl]methanol?
The canonical SMILES for [5-[(1,2-oxazol-3-ylmethylamino)methyl]furan-2-yl]methanol is OCc1ccc(CNCc2ccon2)o1.
What is the InChIKey of [5-[(1,2-oxazol-3-ylmethylamino)methyl]furan-2-yl]methanol?
The InChIKey is LSGKDPWYWOGHPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3/c13-7-10-2-1-9(15-10)6-11-5-8-3-4-14-12-8/h1-4,11,13H,5-7H2.
What are the key properties of [5-[(1,2-oxazol-3-ylmethylamino)methyl]furan-2-yl]methanol?
[5-[(1,2-oxazol-3-ylmethylamino)methyl]furan-2-yl]methanol has a molecular weight of 208.22 g/mol, XLogP of 1.05, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(1,2-oxazol-3-ylmethylamino)methyl]furan-2-yl]methanol is sourced from PubChem (CID 79496028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).