About tert-butyl 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylate
tert-butyl 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 79496302) has the molecular formula C13H17N3O2
and a molecular weight of 247.30 g/mol. Its IUPAC name is tert-butyl 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylate.
Analyze tert-butyl 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylate?
The IUPAC name of tert-butyl 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylate (CID 79496302) is tert-butyl 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylate.
What is the SMILES notation for tert-butyl 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylate?
The canonical SMILES for tert-butyl 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylate is Cc1cc(C)n2ncc(C(=O)OC(C)(C)C)c2n1.
What is the InChIKey of tert-butyl 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylate?
The InChIKey is XWJVPDAOGDTZFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2/c1-8-6-9(2)16-11(15-8)10(7-14-16)12(17)18-13(3,4)5/h6-7H,1-5H3.
What are the key properties of tert-butyl 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylate?
tert-butyl 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylate has a molecular weight of 247.30 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylate is sourced from PubChem (CID 79496302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).