About 1'-prop-2-enylspiro[2,3-dihydrothiochromene-4,5'-4H-imidazole]-2'-amine
1'-prop-2-enylspiro[2,3-dihydrothiochromene-4,5'-4H-imidazole]-2'-amine (PubChem CID 79496560) has the molecular formula C14H17N3S
and a molecular weight of 259.38 g/mol. Its IUPAC name is 1'-prop-2-enylspiro[2,3-dihydrothiochromene-4,5'-4H-imidazole]-2'-amine.
Molecular Properties
| Compound Name | 1'-prop-2-enylspiro[2,3-dihydrothiochromene-4,5'-4H-imidazole]-2'-amine |
| PubChem CID | 79496560 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 1'-prop-2-enylspiro[2,3-dihydrothiochromene-4,5'-4H-imidazole]-2'-amine |
| SMILES | C=CCN1C(N)=NCC12CCSc1ccccc12 |
| InChI | InChI=1S/C14H17N3S/c1-2-8-17-13(15)16-10-14(17)7-9-18-12-6-4-3-5-11(12)14/h2-6H,1,7-10H2,(H2,15,16) |
| InChIKey | AHXKFEUXZLFZRC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1'-prop-2-enylspiro[2,3-dihydrothiochromene-4,5'-4H-imidazole]-2'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-prop-2-enylspiro[2,3-dihydrothiochromene-4,5'-4H-imidazole]-2'-amine?
The IUPAC name of 1'-prop-2-enylspiro[2,3-dihydrothiochromene-4,5'-4H-imidazole]-2'-amine (CID 79496560) is 1'-prop-2-enylspiro[2,3-dihydrothiochromene-4,5'-4H-imidazole]-2'-amine.
What is the SMILES notation for 1'-prop-2-enylspiro[2,3-dihydrothiochromene-4,5'-4H-imidazole]-2'-amine?
The canonical SMILES for 1'-prop-2-enylspiro[2,3-dihydrothiochromene-4,5'-4H-imidazole]-2'-amine is C=CCN1C(N)=NCC12CCSc1ccccc12.
What is the InChIKey of 1'-prop-2-enylspiro[2,3-dihydrothiochromene-4,5'-4H-imidazole]-2'-amine?
The InChIKey is AHXKFEUXZLFZRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3S/c1-2-8-17-13(15)16-10-14(17)7-9-18-12-6-4-3-5-11(12)14/h2-6H,1,7-10H2,(H2,15,16).
What are the key properties of 1'-prop-2-enylspiro[2,3-dihydrothiochromene-4,5'-4H-imidazole]-2'-amine?
1'-prop-2-enylspiro[2,3-dihydrothiochromene-4,5'-4H-imidazole]-2'-amine has a molecular weight of 259.38 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-prop-2-enylspiro[2,3-dihydrothiochromene-4,5'-4H-imidazole]-2'-amine is sourced from PubChem (CID 79496560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).