About 8-methyl-1-prop-2-enyl-1,3-diazaspiro[4.6]undec-2-en-2-amine
8-methyl-1-prop-2-enyl-1,3-diazaspiro[4.6]undec-2-en-2-amine (PubChem CID 79496585) has the molecular formula C13H23N3
and a molecular weight of 221.35 g/mol. Its IUPAC name is 8-methyl-1-prop-2-enyl-1,3-diazaspiro[4.6]undec-2-en-2-amine.
Molecular Properties
| Compound Name | 8-methyl-1-prop-2-enyl-1,3-diazaspiro[4.6]undec-2-en-2-amine |
| PubChem CID | 79496585 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 8-methyl-1-prop-2-enyl-1,3-diazaspiro[4.6]undec-2-en-2-amine |
| SMILES | C=CCN1C(N)=NCC12CCCC(C)CC2 |
| InChI | InChI=1S/C13H23N3/c1-3-9-16-12(14)15-10-13(16)7-4-5-11(2)6-8-13/h3,11H,1,4-10H2,2H3,(H2,14,15) |
| InChIKey | IVONWCUCNMBVBU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-1-prop-2-enyl-1,3-diazaspiro[4.6]undec-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1-prop-2-enyl-1,3-diazaspiro[4.6]undec-2-en-2-amine?
The IUPAC name of 8-methyl-1-prop-2-enyl-1,3-diazaspiro[4.6]undec-2-en-2-amine (CID 79496585) is 8-methyl-1-prop-2-enyl-1,3-diazaspiro[4.6]undec-2-en-2-amine.
What is the SMILES notation for 8-methyl-1-prop-2-enyl-1,3-diazaspiro[4.6]undec-2-en-2-amine?
The canonical SMILES for 8-methyl-1-prop-2-enyl-1,3-diazaspiro[4.6]undec-2-en-2-amine is C=CCN1C(N)=NCC12CCCC(C)CC2.
What is the InChIKey of 8-methyl-1-prop-2-enyl-1,3-diazaspiro[4.6]undec-2-en-2-amine?
The InChIKey is IVONWCUCNMBVBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3/c1-3-9-16-12(14)15-10-13(16)7-4-5-11(2)6-8-13/h3,11H,1,4-10H2,2H3,(H2,14,15).
What are the key properties of 8-methyl-1-prop-2-enyl-1,3-diazaspiro[4.6]undec-2-en-2-amine?
8-methyl-1-prop-2-enyl-1,3-diazaspiro[4.6]undec-2-en-2-amine has a molecular weight of 221.35 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1-prop-2-enyl-1,3-diazaspiro[4.6]undec-2-en-2-amine is sourced from PubChem (CID 79496585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).