About 7-methyl-1-prop-2-enyl-1,3,7-triazaspiro[4.4]non-2-en-2-amine
7-methyl-1-prop-2-enyl-1,3,7-triazaspiro[4.4]non-2-en-2-amine (PubChem CID 79496751) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 7-methyl-1-prop-2-enyl-1,3,7-triazaspiro[4.4]non-2-en-2-amine.
Molecular Properties
| Compound Name | 7-methyl-1-prop-2-enyl-1,3,7-triazaspiro[4.4]non-2-en-2-amine |
| PubChem CID | 79496751 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 7-methyl-1-prop-2-enyl-1,3,7-triazaspiro[4.4]non-2-en-2-amine |
| SMILES | C=CCN1C(N)=NCC12CCN(C)C2 |
| InChI | InChI=1S/C10H18N4/c1-3-5-14-9(11)12-7-10(14)4-6-13(2)8-10/h3H,1,4-8H2,2H3,(H2,11,12) |
| InChIKey | LMIWWHAKBVWTFY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-1-prop-2-enyl-1,3,7-triazaspiro[4.4]non-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1-prop-2-enyl-1,3,7-triazaspiro[4.4]non-2-en-2-amine?
The IUPAC name of 7-methyl-1-prop-2-enyl-1,3,7-triazaspiro[4.4]non-2-en-2-amine (CID 79496751) is 7-methyl-1-prop-2-enyl-1,3,7-triazaspiro[4.4]non-2-en-2-amine.
What is the SMILES notation for 7-methyl-1-prop-2-enyl-1,3,7-triazaspiro[4.4]non-2-en-2-amine?
The canonical SMILES for 7-methyl-1-prop-2-enyl-1,3,7-triazaspiro[4.4]non-2-en-2-amine is C=CCN1C(N)=NCC12CCN(C)C2.
What is the InChIKey of 7-methyl-1-prop-2-enyl-1,3,7-triazaspiro[4.4]non-2-en-2-amine?
The InChIKey is LMIWWHAKBVWTFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c1-3-5-14-9(11)12-7-10(14)4-6-13(2)8-10/h3H,1,4-8H2,2H3,(H2,11,12).
What are the key properties of 7-methyl-1-prop-2-enyl-1,3,7-triazaspiro[4.4]non-2-en-2-amine?
7-methyl-1-prop-2-enyl-1,3,7-triazaspiro[4.4]non-2-en-2-amine has a molecular weight of 194.28 g/mol, XLogP of -0.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1-prop-2-enyl-1,3,7-triazaspiro[4.4]non-2-en-2-amine is sourced from PubChem (CID 79496751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).