About 1-[2-(dimethylamino)ethyl]-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine
1-[2-(dimethylamino)ethyl]-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine (PubChem CID 79496867) has the molecular formula C14H27N5
and a molecular weight of 265.40 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine.
Molecular Properties
| Compound Name | 1-[2-(dimethylamino)ethyl]-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine |
| PubChem CID | 79496867 |
| Molecular Formula | C14H27N5 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.23 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine |
| SMILES | CN(C)CCN1C(N)=NCC12CC1CCC(C2)N1C |
| InChI | InChI=1S/C14H27N5/c1-17(2)6-7-19-13(15)16-10-14(19)8-11-4-5-12(9-14)18(11)3/h11-12H,4-10H2,1-3H3,(H2,15,16) |
| InChIKey | XVFBUUVYBUJCRL-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(dimethylamino)ethyl]-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(dimethylamino)ethyl]-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine?
The IUPAC name of 1-[2-(dimethylamino)ethyl]-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine (CID 79496867) is 1-[2-(dimethylamino)ethyl]-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine.
What is the SMILES notation for 1-[2-(dimethylamino)ethyl]-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine?
The canonical SMILES for 1-[2-(dimethylamino)ethyl]-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine is CN(C)CCN1C(N)=NCC12CC1CCC(C2)N1C.
What is the InChIKey of 1-[2-(dimethylamino)ethyl]-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine?
The InChIKey is XVFBUUVYBUJCRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N5/c1-17(2)6-7-19-13(15)16-10-14(19)8-11-4-5-12(9-14)18(11)3/h11-12H,4-10H2,1-3H3,(H2,15,16).
What are the key properties of 1-[2-(dimethylamino)ethyl]-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine?
1-[2-(dimethylamino)ethyl]-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine has a molecular weight of 265.40 g/mol, XLogP of 0.17, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(dimethylamino)ethyl]-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine is sourced from PubChem (CID 79496867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).