About 1-cycloheptyl-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine
1-cycloheptyl-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine (PubChem CID 79497290) has the molecular formula C17H30N4
and a molecular weight of 290.46 g/mol. Its IUPAC name is 1-cycloheptyl-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine.
Molecular Properties
| Compound Name | 1-cycloheptyl-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine |
| PubChem CID | 79497290 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 1-cycloheptyl-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine |
| SMILES | CN1C2CCC1CC1(CN=C(N)N1C1CCCCCC1)C2 |
| InChI | InChI=1S/C17H30N4/c1-20-14-8-9-15(20)11-17(10-14)12-19-16(18)21(17)13-6-4-2-3-5-7-13/h13-15H,2-12H2,1H3,(H2,18,19) |
| InChIKey | JHGCNFYXCJPCCB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cycloheptyl-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cycloheptyl-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine?
The IUPAC name of 1-cycloheptyl-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine (CID 79497290) is 1-cycloheptyl-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine.
What is the SMILES notation for 1-cycloheptyl-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine?
The canonical SMILES for 1-cycloheptyl-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine is CN1C2CCC1CC1(CN=C(N)N1C1CCCCCC1)C2.
What is the InChIKey of 1-cycloheptyl-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine?
The InChIKey is JHGCNFYXCJPCCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N4/c1-20-14-8-9-15(20)11-17(10-14)12-19-16(18)21(17)13-6-4-2-3-5-7-13/h13-15H,2-12H2,1H3,(H2,18,19).
What are the key properties of 1-cycloheptyl-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine?
1-cycloheptyl-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine has a molecular weight of 290.46 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cycloheptyl-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine is sourced from PubChem (CID 79497290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).