About 5-ethyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine
5-ethyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine (PubChem CID 79497493) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 5-ethyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | 5-ethyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine |
| PubChem CID | 79497493 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 5-ethyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine |
| SMILES | C=CCN1C(N)=NCC1CC |
| InChI | InChI=1S/C8H15N3/c1-3-5-11-7(4-2)6-10-8(11)9/h3,7H,1,4-6H2,2H3,(H2,9,10) |
| InChIKey | PLHTVKQQLVUCMP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine?
The IUPAC name of 5-ethyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine (CID 79497493) is 5-ethyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for 5-ethyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine?
The canonical SMILES for 5-ethyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine is C=CCN1C(N)=NCC1CC.
What is the InChIKey of 5-ethyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine?
The InChIKey is PLHTVKQQLVUCMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-3-5-11-7(4-2)6-10-8(11)9/h3,7H,1,4-6H2,2H3,(H2,9,10).
What are the key properties of 5-ethyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine?
5-ethyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine has a molecular weight of 153.23 g/mol, XLogP of 0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-prop-2-enyl-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 79497493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).