C10H15N5 — CID 79497687
5-(1-methylpyrazol-4-yl)-1-prop-2-enyl-4,5-dihydroimidazol-2-amine (PubChem CID 79497687) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-(1-methylpyrazol-4-yl)-1-prop-2-enyl-4,5-dihydroimidazol-2-amine.
| Compound Name | 5-(1-methylpyrazol-4-yl)-1-prop-2-enyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79497687 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 5-(1-methylpyrazol-4-yl)-1-prop-2-enyl-4,5-dihydroimidazol-2-amine |
| SMILES | C=CCN1C(N)=NCC1c1cnn(C)c1 |
| InChI | InChI=1S/C10H15N5/c1-3-4-15-9(6-12-10(15)11)8-5-13-14(2)7-8/h3,5,7,9H,1,4,6H2,2H3,(H2,11,12) |
| InChIKey | GODHJIXBJKMNIW-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|