About 1-prop-2-enyl-7-oxa-1,3-diazaspiro[4.4]non-2-en-2-amine
1-prop-2-enyl-7-oxa-1,3-diazaspiro[4.4]non-2-en-2-amine (PubChem CID 79498418) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-prop-2-enyl-7-oxa-1,3-diazaspiro[4.4]non-2-en-2-amine.
Molecular Properties
| Compound Name | 1-prop-2-enyl-7-oxa-1,3-diazaspiro[4.4]non-2-en-2-amine |
| PubChem CID | 79498418 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 1-prop-2-enyl-7-oxa-1,3-diazaspiro[4.4]non-2-en-2-amine |
| SMILES | C=CCN1C(N)=NCC12CCOC2 |
| InChI | InChI=1S/C9H15N3O/c1-2-4-12-8(10)11-6-9(12)3-5-13-7-9/h2H,1,3-7H2,(H2,10,11) |
| InChIKey | MZRMPVNXKHQOLN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enyl-7-oxa-1,3-diazaspiro[4.4]non-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enyl-7-oxa-1,3-diazaspiro[4.4]non-2-en-2-amine?
The IUPAC name of 1-prop-2-enyl-7-oxa-1,3-diazaspiro[4.4]non-2-en-2-amine (CID 79498418) is 1-prop-2-enyl-7-oxa-1,3-diazaspiro[4.4]non-2-en-2-amine.
What is the SMILES notation for 1-prop-2-enyl-7-oxa-1,3-diazaspiro[4.4]non-2-en-2-amine?
The canonical SMILES for 1-prop-2-enyl-7-oxa-1,3-diazaspiro[4.4]non-2-en-2-amine is C=CCN1C(N)=NCC12CCOC2.
What is the InChIKey of 1-prop-2-enyl-7-oxa-1,3-diazaspiro[4.4]non-2-en-2-amine?
The InChIKey is MZRMPVNXKHQOLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-2-4-12-8(10)11-6-9(12)3-5-13-7-9/h2H,1,3-7H2,(H2,10,11).
What are the key properties of 1-prop-2-enyl-7-oxa-1,3-diazaspiro[4.4]non-2-en-2-amine?
1-prop-2-enyl-7-oxa-1,3-diazaspiro[4.4]non-2-en-2-amine has a molecular weight of 181.24 g/mol, XLogP of -0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enyl-7-oxa-1,3-diazaspiro[4.4]non-2-en-2-amine is sourced from PubChem (CID 79498418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).