About 1-cycloheptyl-9-methyl-1,3,9-triazaspiro[4.6]undec-2-en-2-amine
1-cycloheptyl-9-methyl-1,3,9-triazaspiro[4.6]undec-2-en-2-amine (PubChem CID 79498589) has the molecular formula C16H30N4
and a molecular weight of 278.44 g/mol. Its IUPAC name is 1-cycloheptyl-9-methyl-1,3,9-triazaspiro[4.6]undec-2-en-2-amine.
Molecular Properties
| Compound Name | 1-cycloheptyl-9-methyl-1,3,9-triazaspiro[4.6]undec-2-en-2-amine |
| PubChem CID | 79498589 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 1-cycloheptyl-9-methyl-1,3,9-triazaspiro[4.6]undec-2-en-2-amine |
| SMILES | CN1CCCC2(CC1)CN=C(N)N2C1CCCCCC1 |
| InChI | InChI=1S/C16H30N4/c1-19-11-6-9-16(10-12-19)13-18-15(17)20(16)14-7-4-2-3-5-8-14/h14H,2-13H2,1H3,(H2,17,18) |
| InChIKey | YRJYANCRMWELTA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cycloheptyl-9-methyl-1,3,9-triazaspiro[4.6]undec-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cycloheptyl-9-methyl-1,3,9-triazaspiro[4.6]undec-2-en-2-amine?
The IUPAC name of 1-cycloheptyl-9-methyl-1,3,9-triazaspiro[4.6]undec-2-en-2-amine (CID 79498589) is 1-cycloheptyl-9-methyl-1,3,9-triazaspiro[4.6]undec-2-en-2-amine.
What is the SMILES notation for 1-cycloheptyl-9-methyl-1,3,9-triazaspiro[4.6]undec-2-en-2-amine?
The canonical SMILES for 1-cycloheptyl-9-methyl-1,3,9-triazaspiro[4.6]undec-2-en-2-amine is CN1CCCC2(CC1)CN=C(N)N2C1CCCCCC1.
What is the InChIKey of 1-cycloheptyl-9-methyl-1,3,9-triazaspiro[4.6]undec-2-en-2-amine?
The InChIKey is YRJYANCRMWELTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N4/c1-19-11-6-9-16(10-12-19)13-18-15(17)20(16)14-7-4-2-3-5-8-14/h14H,2-13H2,1H3,(H2,17,18).
What are the key properties of 1-cycloheptyl-9-methyl-1,3,9-triazaspiro[4.6]undec-2-en-2-amine?
1-cycloheptyl-9-methyl-1,3,9-triazaspiro[4.6]undec-2-en-2-amine has a molecular weight of 278.44 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cycloheptyl-9-methyl-1,3,9-triazaspiro[4.6]undec-2-en-2-amine is sourced from PubChem (CID 79498589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).