C15H19N3O — CID 79498722
5-methoxy-1'-prop-2-enylspiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine (PubChem CID 79498722) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 5-methoxy-1'-prop-2-enylspiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine.
| Compound Name | 5-methoxy-1'-prop-2-enylspiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine |
|---|---|
| PubChem CID | 79498722 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 5-methoxy-1'-prop-2-enylspiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine |
| SMILES | C=CCN1C(N)=NCC12CCc1ccc(OC)cc12 |
| InChI | InChI=1S/C15H19N3O/c1-3-8-18-14(16)17-10-15(18)7-6-11-4-5-12(19-2)9-13(11)15/h3-5,9H,1,6-8,10H2,2H3,(H2,16,17) |
| InChIKey | WAYCWLOXLQVORL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|