About 3-aminopentanimidamide
3-aminopentanimidamide (PubChem CID 79498775) has the molecular formula C5H13N3
and a molecular weight of 115.18 g/mol. Its IUPAC name is 3-aminopentanimidamide.
Molecular Properties
| Compound Name | 3-aminopentanimidamide |
| PubChem CID | 79498775 |
| Molecular Formula | C5H13N3 |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.11 |
| IUPAC Name | 3-aminopentanimidamide |
| SMILES | [H]/N=C(\N)CC(N)CC |
| InChI | InChI=1S/C5H13N3/c1-2-4(6)3-5(7)8/h4H,2-3,6H2,1H3,(H3,7,8) |
| InChIKey | JIYUVYWEUJVNPU-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopentanimidamide?
The IUPAC name of 3-aminopentanimidamide (CID 79498775) is 3-aminopentanimidamide.
What is the SMILES notation for 3-aminopentanimidamide?
The canonical SMILES for 3-aminopentanimidamide is [H]/N=C(\N)CC(N)CC.
What is the InChIKey of 3-aminopentanimidamide?
The InChIKey is JIYUVYWEUJVNPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3/c1-2-4(6)3-5(7)8/h4H,2-3,6H2,1H3,(H3,7,8).
What are the key properties of 3-aminopentanimidamide?
3-aminopentanimidamide has a molecular weight of 115.18 g/mol, XLogP of 0.05, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopentanimidamide is sourced from PubChem (CID 79498775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).