About 9-methyl-1-propan-2-yl-1,3-diazaspiro[4.4]non-2-en-2-amine
9-methyl-1-propan-2-yl-1,3-diazaspiro[4.4]non-2-en-2-amine (PubChem CID 79498909) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is 9-methyl-1-propan-2-yl-1,3-diazaspiro[4.4]non-2-en-2-amine.
Molecular Properties
| Compound Name | 9-methyl-1-propan-2-yl-1,3-diazaspiro[4.4]non-2-en-2-amine |
| PubChem CID | 79498909 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 9-methyl-1-propan-2-yl-1,3-diazaspiro[4.4]non-2-en-2-amine |
| SMILES | CC(C)N1C(N)=NCC12CCCC2C |
| InChI | InChI=1S/C11H21N3/c1-8(2)14-10(12)13-7-11(14)6-4-5-9(11)3/h8-9H,4-7H2,1-3H3,(H2,12,13) |
| InChIKey | CDBBFWNGFAUCQX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-methyl-1-propan-2-yl-1,3-diazaspiro[4.4]non-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-1-propan-2-yl-1,3-diazaspiro[4.4]non-2-en-2-amine?
The IUPAC name of 9-methyl-1-propan-2-yl-1,3-diazaspiro[4.4]non-2-en-2-amine (CID 79498909) is 9-methyl-1-propan-2-yl-1,3-diazaspiro[4.4]non-2-en-2-amine.
What is the SMILES notation for 9-methyl-1-propan-2-yl-1,3-diazaspiro[4.4]non-2-en-2-amine?
The canonical SMILES for 9-methyl-1-propan-2-yl-1,3-diazaspiro[4.4]non-2-en-2-amine is CC(C)N1C(N)=NCC12CCCC2C.
What is the InChIKey of 9-methyl-1-propan-2-yl-1,3-diazaspiro[4.4]non-2-en-2-amine?
The InChIKey is CDBBFWNGFAUCQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c1-8(2)14-10(12)13-7-11(14)6-4-5-9(11)3/h8-9H,4-7H2,1-3H3,(H2,12,13).
What are the key properties of 9-methyl-1-propan-2-yl-1,3-diazaspiro[4.4]non-2-en-2-amine?
9-methyl-1-propan-2-yl-1,3-diazaspiro[4.4]non-2-en-2-amine has a molecular weight of 195.31 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-1-propan-2-yl-1,3-diazaspiro[4.4]non-2-en-2-amine is sourced from PubChem (CID 79498909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).