C14H16F3N3O — CID 79499144
1-(oxolan-2-ylmethyl)-5-(3,4,5-trifluorophenyl)-4,5-dihydroimidazol-2-amine (PubChem CID 79499144) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-5-(3,4,5-trifluorophenyl)-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-(oxolan-2-ylmethyl)-5-(3,4,5-trifluorophenyl)-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79499144 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-5-(3,4,5-trifluorophenyl)-4,5-dihydroimidazol-2-amine |
| SMILES | NC1=NCC(c2cc(F)c(F)c(F)c2)N1CC1CCCO1 |
| InChI | InChI=1S/C14H16F3N3O/c15-10-4-8(5-11(16)13(10)17)12-6-19-14(18)20(12)7-9-2-1-3-21-9/h4-5,9,12H,1-3,6-7H2,(H2,18,19) |
| InChIKey | PGEWMFHXBHCEIH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|