About 1'-(3-chlorophenyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine
1'-(3-chlorophenyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine (PubChem CID 79499915) has the molecular formula C17H16ClN3
and a molecular weight of 297.79 g/mol. Its IUPAC name is 1'-(3-chlorophenyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine.
Molecular Properties
| Compound Name | 1'-(3-chlorophenyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine |
| PubChem CID | 79499915 |
| Molecular Formula | C17H16ClN3 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1'-(3-chlorophenyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine |
| SMILES | NC1=NCC2(CCc3ccccc32)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H16ClN3/c18-13-5-3-6-14(10-13)21-16(19)20-11-17(21)9-8-12-4-1-2-7-15(12)17/h1-7,10H,8-9,11H2,(H2,19,20) |
| InChIKey | IDADUGQTJNJYOW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-(3-chlorophenyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(3-chlorophenyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine?
The IUPAC name of 1'-(3-chlorophenyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine (CID 79499915) is 1'-(3-chlorophenyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine.
What is the SMILES notation for 1'-(3-chlorophenyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine?
The canonical SMILES for 1'-(3-chlorophenyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine is NC1=NCC2(CCc3ccccc32)N1c1cccc(Cl)c1.
What is the InChIKey of 1'-(3-chlorophenyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine?
The InChIKey is IDADUGQTJNJYOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN3/c18-13-5-3-6-14(10-13)21-16(19)20-11-17(21)9-8-12-4-1-2-7-15(12)17/h1-7,10H,8-9,11H2,(H2,19,20).
What are the key properties of 1'-(3-chlorophenyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine?
1'-(3-chlorophenyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine has a molecular weight of 297.79 g/mol, XLogP of 3.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(3-chlorophenyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine is sourced from PubChem (CID 79499915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).